C21H34N6O — CID 119162954
N-(2-cyclohexylcyclopropyl)-N'-ethyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide (PubChem CID 119162954) has the molecular formula C21H34N6O and a molecular weight of 386.54 g/mol. Its IUPAC name is N-(2-cyclohexylcyclopropyl)-N'-ethyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-(2-cyclohexylcyclopropyl)-N'-ethyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119162954 |
| Molecular Formula | C21H34N6O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | N-(2-cyclohexylcyclopropyl)-N'-ethyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide |
| SMILES | CC/N=C(/NC1CC1C1CCCCC1)N1CCN(c2nccn(C)c2=O)CC1 |
| InChI | InChI=1S/C21H34N6O/c1-3-22-21(24-18-15-17(18)16-7-5-4-6-8-16)27-13-11-26(12-14-27)19-20(28)25(2)10-9-23-19/h9-10,16-18H,3-8,11-15H2,1-2H3,(H,22,24) |
| InChIKey | OXVYXNKVDKBKEE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|