C19H30N6O2 — CID 119163093
N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide (PubChem CID 119163093) has the molecular formula C19H30N6O2 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119163093 |
| Molecular Formula | C19H30N6O2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(/NC1C2CCOC2C1(C)C)N1CCN(c2nccn(C)c2=O)CC1 |
| InChI | InChI=1S/C19H30N6O2/c1-19(2)14(13-5-12-27-15(13)19)22-18(20-3)25-10-8-24(9-11-25)16-17(26)23(4)7-6-21-16/h6-7,13-15H,5,8-12H2,1-4H3,(H,20,22) |
| InChIKey | VYJNTYYRHLMWOY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|