C22H26N6O — CID 119152345
N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)-N-(naphthalen-1-ylmethyl)piperazine-1-carboximidamide (PubChem CID 119152345) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)-N-(naphthalen-1-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)-N-(naphthalen-1-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119152345 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)-N-(naphthalen-1-ylmethyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCc1cccc2ccccc12)N1CCN(c2nccn(C)c2=O)CC1 |
| InChI | InChI=1S/C22H26N6O/c1-23-22(25-16-18-8-5-7-17-6-3-4-9-19(17)18)28-14-12-27(13-15-28)20-21(29)26(2)11-10-24-20/h3-11H,12-16H2,1-2H3,(H,23,25) |
| InChIKey | GXWJFPVCPUWBSB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|