C19H26FIN6O2 — CID 119153100
N-[2-(2-fluorophenyl)-2-hydroxyethyl]-N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 119153100) has the molecular formula C19H26FIN6O2 and a molecular weight of 516.36 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-2-hydroxyethyl]-N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119153100 |
| Molecular Formula | C19H26FIN6O2 |
| Molecular Weight | 516.36 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(O)c1ccccc1F)N1CCN(c2nccn(C)c2=O)CC1.I |
| InChI | InChI=1S/C19H25FN6O2.HI/c1-21-19(23-13-16(27)14-5-3-4-6-15(14)20)26-11-9-25(10-12-26)17-18(28)24(2)8-7-22-17;/h3-8,16,27H,9-13H2,1-2H3,(H,21,23);1H |
| InChIKey | VDIWSLWHEWLUEF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|