C18H22F2N6O — CID 119154608
N-[(2,5-difluorophenyl)methyl]-N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide (PubChem CID 119154608) has the molecular formula C18H22F2N6O and a molecular weight of 376.41 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119154608 |
| Molecular Formula | C18H22F2N6O |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-N'-methyl-4-(4-methyl-3-oxopyrazin-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cc(F)ccc1F)N1CCN(c2nccn(C)c2=O)CC1 |
| InChI | InChI=1S/C18H22F2N6O/c1-21-18(23-12-13-11-14(19)3-4-15(13)20)26-9-7-25(8-10-26)16-17(27)24(2)6-5-22-16/h3-6,11H,7-10,12H2,1-2H3,(H,21,23) |
| InChIKey | PWLXTLGKTROPHB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|