C19H25FN6O — CID 111205502
N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111205502) has the molecular formula C19H25FN6O and a molecular weight of 372.45 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111205502 |
| Molecular Formula | C19H25FN6O |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccccc1F)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H25FN6O/c1-2-21-18(24-14-17(27)15-6-3-4-7-16(15)20)25-10-12-26(13-11-25)19-22-8-5-9-23-19/h3-9,17,27H,2,10-14H2,1H3,(H,21,24) |
| InChIKey | KHLDJRKFPASUSP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|