C19H28FN3O — CID 111994717
N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-azaspiro[4.4]nonane-2-carboximidamide (PubChem CID 111994717) has the molecular formula C19H28FN3O and a molecular weight of 333.45 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-azaspiro[4.4]nonane-2-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-azaspiro[4.4]nonane-2-carboximidamide |
|---|---|
| PubChem CID | 111994717 |
| Molecular Formula | C19H28FN3O |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-azaspiro[4.4]nonane-2-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccccc1F)N1CCC2(CCCC2)C1 |
| InChI | InChI=1S/C19H28FN3O/c1-2-21-18(23-12-11-19(14-23)9-5-6-10-19)22-13-17(24)15-7-3-4-8-16(15)20/h3-4,7-8,17,24H,2,5-6,9-14H2,1H3,(H,21,22) |
| InChIKey | MWQGOUXHEPIZLN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|