C19H27N7O — CID 119159184
N-ethyl-4-(4-methyl-3-oxopyrazin-2-yl)-N'-(2-pyridin-4-ylethyl)piperazine-1-carboximidamide (PubChem CID 119159184) has the molecular formula C19H27N7O and a molecular weight of 369.47 g/mol. Its IUPAC name is N-ethyl-4-(4-methyl-3-oxopyrazin-2-yl)-N'-(2-pyridin-4-ylethyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(4-methyl-3-oxopyrazin-2-yl)-N'-(2-pyridin-4-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119159184 |
| Molecular Formula | C19H27N7O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | N-ethyl-4-(4-methyl-3-oxopyrazin-2-yl)-N'-(2-pyridin-4-ylethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1ccncc1)N1CCN(c2nccn(C)c2=O)CC1 |
| InChI | InChI=1S/C19H27N7O/c1-3-21-19(23-9-6-16-4-7-20-8-5-16)26-14-12-25(13-15-26)17-18(27)24(2)11-10-22-17/h4-5,7-8,10-11H,3,6,9,12-15H2,1-2H3,(H,21,23) |
| InChIKey | WYYVTMMLNKLFPZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|