C17H25N5O — CID 119158924
4-cyclopropyl-N-ethyl-3-oxo-N'-(2-pyridin-4-ylethyl)piperazine-1-carboximidamide (PubChem CID 119158924) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-cyclopropyl-N-ethyl-3-oxo-N'-(2-pyridin-4-ylethyl)piperazine-1-carboximidamide.
| Compound Name | 4-cyclopropyl-N-ethyl-3-oxo-N'-(2-pyridin-4-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119158924 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 4-cyclopropyl-N-ethyl-3-oxo-N'-(2-pyridin-4-ylethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1ccncc1)N1CCN(C2CC2)C(=O)C1 |
| InChI | InChI=1S/C17H25N5O/c1-2-19-17(20-10-7-14-5-8-18-9-6-14)21-11-12-22(15-3-4-15)16(23)13-21/h5-6,8-9,15H,2-4,7,10-13H2,1H3,(H,19,20) |
| InChIKey | SDGWXZBKNZYCHA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|