C17H28IN5OS — CID 119158866
4-cyclopropyl-N'-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-N-ethyl-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 119158866) has the molecular formula C17H28IN5OS and a molecular weight of 477.42 g/mol. Its IUPAC name is 4-cyclopropyl-N'-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-N-ethyl-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-cyclopropyl-N'-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-N-ethyl-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119158866 |
| Molecular Formula | C17H28IN5OS |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 4-cyclopropyl-N'-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-N-ethyl-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1sc(C)nc1C)N1CCN(C2CC2)C(=O)C1.I |
| InChI | InChI=1S/C17H27N5OS.HI/c1-4-18-17(19-8-7-15-12(2)20-13(3)24-15)21-9-10-22(14-5-6-14)16(23)11-21;/h14H,4-11H2,1-3H3,(H,18,19);1H |
| InChIKey | YIEONRCUBRDJIB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|