C15H27N5O2 — CID 119158926
2-[[(4-cyclopropyl-3-oxopiperazin-1-yl)-(ethylamino)methylidene]amino]-N-propan-2-ylacetamide (PubChem CID 119158926) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-[[(4-cyclopropyl-3-oxopiperazin-1-yl)-(ethylamino)methylidene]amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[(4-cyclopropyl-3-oxopiperazin-1-yl)-(ethylamino)methylidene]amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 119158926 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 2-[[(4-cyclopropyl-3-oxopiperazin-1-yl)-(ethylamino)methylidene]amino]-N-propan-2-ylacetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)C)N1CCN(C2CC2)C(=O)C1 |
| InChI | InChI=1S/C15H27N5O2/c1-4-16-15(17-9-13(21)18-11(2)3)19-7-8-20(12-5-6-12)14(22)10-19/h11-12H,4-10H2,1-3H3,(H,16,17)(H,18,21) |
| InChIKey | XOVUNYVGOXTLQP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|