C19H26N6O — CID 111206514
N-ethyl-N'-[2-(3-hydroxyphenyl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111206514) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is N-ethyl-N'-[2-(3-hydroxyphenyl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(3-hydroxyphenyl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111206514 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | N-ethyl-N'-[2-(3-hydroxyphenyl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1cccc(O)c1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H26N6O/c1-2-20-18(23-10-7-16-5-3-6-17(26)15-16)24-11-13-25(14-12-24)19-21-8-4-9-22-19/h3-6,8-9,15,26H,2,7,10-14H2,1H3,(H,20,23) |
| InChIKey | ZVXQSCKEFBOIQW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|