C17H24BrIN6S — CID 111206441
N'-[2-(5-bromothiophen-2-yl)ethyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111206441) has the molecular formula C17H24BrIN6S and a molecular weight of 551.30 g/mol. Its IUPAC name is N'-[2-(5-bromothiophen-2-yl)ethyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(5-bromothiophen-2-yl)ethyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111206441 |
| Molecular Formula | C17H24BrIN6S |
| Molecular Weight | 551.30 g/mol |
| Exact Mass | 550.00 |
| IUPAC Name | N'-[2-(5-bromothiophen-2-yl)ethyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(Br)s1)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C17H23BrN6S.HI/c1-2-19-16(22-9-6-14-4-5-15(18)25-14)23-10-12-24(13-11-23)17-20-7-3-8-21-17;/h3-5,7-8H,2,6,9-13H2,1H3,(H,19,22);1H |
| InChIKey | QTOVBESKCVCEGD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|