C22H31FN4O2 — CID 111346441
N'-ethyl-N-[2-(2-fluorophenyl)cyclopropyl]-4-(morpholine-4-carbonyl)piperidine-1-carboximidamide (PubChem CID 111346441) has the molecular formula C22H31FN4O2 and a molecular weight of 402.51 g/mol. Its IUPAC name is N'-ethyl-N-[2-(2-fluorophenyl)cyclopropyl]-4-(morpholine-4-carbonyl)piperidine-1-carboximidamide.
| Compound Name | N'-ethyl-N-[2-(2-fluorophenyl)cyclopropyl]-4-(morpholine-4-carbonyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111346441 |
| Molecular Formula | C22H31FN4O2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | N'-ethyl-N-[2-(2-fluorophenyl)cyclopropyl]-4-(morpholine-4-carbonyl)piperidine-1-carboximidamide |
| SMILES | CC/N=C(/NC1CC1c1ccccc1F)N1CCC(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C22H31FN4O2/c1-2-24-22(25-20-15-18(20)17-5-3-4-6-19(17)23)27-9-7-16(8-10-27)21(28)26-11-13-29-14-12-26/h3-6,16,18,20H,2,7-15H2,1H3,(H,24,25) |
| InChIKey | CJFLJIGXKPGDMY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|