C24H38IN3O2 — CID 109449846
N'-ethyl-N-[2-(2-methylphenyl)cyclopropyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109449846) has the molecular formula C24H38IN3O2 and a molecular weight of 527.49 g/mol. Its IUPAC name is N'-ethyl-N-[2-(2-methylphenyl)cyclopropyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-ethyl-N-[2-(2-methylphenyl)cyclopropyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109449846 |
| Molecular Formula | C24H38IN3O2 |
| Molecular Weight | 527.49 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | N'-ethyl-N-[2-(2-methylphenyl)cyclopropyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CC/N=C(/NC1CC1c1ccccc1C)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C24H37N3O2.HI/c1-3-25-24(26-23-16-22(23)21-10-5-4-8-18(21)2)27-13-11-19(12-14-27)29-17-20-9-6-7-15-28-20;/h4-5,8,10,19-20,22-23H,3,6-7,9,11-17H2,1-2H3,(H,25,26);1H |
| InChIKey | QKNHSQXZWYLRHR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|