C25H38IN3O2 — CID 109450222
N'-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109450222) has the molecular formula C25H38IN3O2 and a molecular weight of 539.50 g/mol. Its IUPAC name is N'-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109450222 |
| Molecular Formula | C25H38IN3O2 |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | N'-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1C2Cc3ccccc3C12)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C25H37N3O2.HI/c1-2-26-25(27-16-23-22-15-18-7-3-4-9-21(18)24(22)23)28-12-10-19(11-13-28)30-17-20-8-5-6-14-29-20;/h3-4,7,9,19-20,22-24H,2,5-6,8,10-17H2,1H3,(H,26,27);1H |
| InChIKey | BOCJTRQDFGWKTQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|