C26H42N4O2 — CID 109448505
N'-[(1-benzylpyrrolidin-2-yl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109448505) has the molecular formula C26H42N4O2 and a molecular weight of 442.65 g/mol. Its IUPAC name is N'-[(1-benzylpyrrolidin-2-yl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N'-[(1-benzylpyrrolidin-2-yl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109448505 |
| Molecular Formula | C26H42N4O2 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | N'-[(1-benzylpyrrolidin-2-yl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCCN1Cc1ccccc1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C26H42N4O2/c1-2-27-26(28-19-23-11-8-15-30(23)20-22-9-4-3-5-10-22)29-16-13-24(14-17-29)32-21-25-12-6-7-18-31-25/h3-5,9-10,23-25H,2,6-8,11-21H2,1H3,(H,27,28) |
| InChIKey | ZQSSOLQSZCBLLZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|