C21H32BrN3O2 — CID 109446959
N'-[(4-bromophenyl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109446959) has the molecular formula C21H32BrN3O2 and a molecular weight of 438.41 g/mol. Its IUPAC name is N'-[(4-bromophenyl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N'-[(4-bromophenyl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109446959 |
| Molecular Formula | C21H32BrN3O2 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N'-[(4-bromophenyl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(Br)cc1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C21H32BrN3O2/c1-2-23-21(24-15-17-6-8-18(22)9-7-17)25-12-10-19(11-13-25)27-16-20-5-3-4-14-26-20/h6-9,19-20H,2-5,10-16H2,1H3,(H,23,24) |
| InChIKey | GKSHNBPMCJKHJK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|