C24H39IN4O3 — CID 109447670
N'-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109447670) has the molecular formula C24H39IN4O3 and a molecular weight of 558.51 g/mol. Its IUPAC name is N'-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109447670 |
| Molecular Formula | C24H39IN4O3 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | N'-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCC2CC2)nc1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C24H38N4O3.HI/c1-2-25-24(27-16-20-8-9-23(26-15-20)31-17-19-6-7-19)28-12-10-21(11-13-28)30-18-22-5-3-4-14-29-22;/h8-9,15,19,21-22H,2-7,10-14,16-18H2,1H3,(H,25,27);1H |
| InChIKey | OBZWBPOZKAURLN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 68.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|