C20H30FN3O2 — CID 111748478
N'-ethyl-N-[2-(2-fluorophenyl)cyclopropyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111748478) has the molecular formula C20H30FN3O2 and a molecular weight of 363.48 g/mol. Its IUPAC name is N'-ethyl-N-[2-(2-fluorophenyl)cyclopropyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-ethyl-N-[2-(2-fluorophenyl)cyclopropyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111748478 |
| Molecular Formula | C20H30FN3O2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | N'-ethyl-N-[2-(2-fluorophenyl)cyclopropyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CC/N=C(/NC1CC1c1ccccc1F)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C20H30FN3O2/c1-3-22-20(24-9-8-15(13-24)14-26-11-10-25-2)23-19-12-17(19)16-6-4-5-7-18(16)21/h4-7,15,17,19H,3,8-14H2,1-2H3,(H,22,23) |
| InChIKey | YNKGHEJLILOSNQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|