C20H32FIN4 — CID 111019486
2-ethyl-1-[2-(2-fluorophenyl)cyclopropyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111019486) has the molecular formula C20H32FIN4 and a molecular weight of 474.41 g/mol. Its IUPAC name is 2-ethyl-1-[2-(2-fluorophenyl)cyclopropyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 2-ethyl-1-[2-(2-fluorophenyl)cyclopropyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111019486 |
| Molecular Formula | C20H32FIN4 |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-ethyl-1-[2-(2-fluorophenyl)cyclopropyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/CC)NC2CC2c2ccccc2F)CC1.I |
| InChI | InChI=1S/C20H31FN4.HI/c1-3-11-25-12-9-15(10-13-25)23-20(22-4-2)24-19-14-17(19)16-7-5-6-8-18(16)21;/h5-8,15,17,19H,3-4,9-14H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | OGJSMJJMTZMUJN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|