C20H31FIN3OS — CID 109440332
2-ethyl-1-(3-ethylsulfinylcyclohexyl)-3-[2-(2-fluorophenyl)cyclopropyl]guanidine;hydroiodide (PubChem CID 109440332) has the molecular formula C20H31FIN3OS and a molecular weight of 507.46 g/mol. Its IUPAC name is 2-ethyl-1-(3-ethylsulfinylcyclohexyl)-3-[2-(2-fluorophenyl)cyclopropyl]guanidine;hydroiodide.
| Compound Name | 2-ethyl-1-(3-ethylsulfinylcyclohexyl)-3-[2-(2-fluorophenyl)cyclopropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109440332 |
| Molecular Formula | C20H31FIN3OS |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 2-ethyl-1-(3-ethylsulfinylcyclohexyl)-3-[2-(2-fluorophenyl)cyclopropyl]guanidine;hydroiodide |
| SMILES | CC/N=C(/NC1CCCC(S(=O)CC)C1)NC1CC1c1ccccc1F.I |
| InChI | InChI=1S/C20H30FN3OS.HI/c1-3-22-20(23-14-8-7-9-15(12-14)26(25)4-2)24-19-13-17(19)16-10-5-6-11-18(16)21;/h5-6,10-11,14-15,17,19H,3-4,7-9,12-13H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | BYNFVBJDGVJGLF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|