C21H34IN3OS — CID 109440834
2-ethyl-1-(3-ethylsulfinylcyclohexyl)-3-[2-(2-methylphenyl)cyclopropyl]guanidine;hydroiodide (PubChem CID 109440834) has the molecular formula C21H34IN3OS and a molecular weight of 503.49 g/mol. Its IUPAC name is 2-ethyl-1-(3-ethylsulfinylcyclohexyl)-3-[2-(2-methylphenyl)cyclopropyl]guanidine;hydroiodide.
| Compound Name | 2-ethyl-1-(3-ethylsulfinylcyclohexyl)-3-[2-(2-methylphenyl)cyclopropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109440834 |
| Molecular Formula | C21H34IN3OS |
| Molecular Weight | 503.49 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 2-ethyl-1-(3-ethylsulfinylcyclohexyl)-3-[2-(2-methylphenyl)cyclopropyl]guanidine;hydroiodide |
| SMILES | CC/N=C(/NC1CCCC(S(=O)CC)C1)NC1CC1c1ccccc1C.I |
| InChI | InChI=1S/C21H33N3OS.HI/c1-4-22-21(23-16-10-8-11-17(13-16)26(25)5-2)24-20-14-19(20)18-12-7-6-9-15(18)3;/h6-7,9,12,16-17,19-20H,4-5,8,10-11,13-14H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | KTHZIIJPWCGGEG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|