C20H34IN3O2S — CID 110057085
1-cyclopentyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(furan-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 110057085) has the molecular formula C20H34IN3O2S and a molecular weight of 507.48 g/mol. Its IUPAC name is 1-cyclopentyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(furan-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110057085 |
| Molecular Formula | C20H34IN3O2S |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 1-cyclopentyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/CCc2ccco2)NC2CCCC2)C1.I |
| InChI | InChI=1S/C20H33N3O2S.HI/c1-2-26(24)19-11-5-9-17(15-19)23-20(22-16-7-3-4-8-16)21-13-12-18-10-6-14-25-18;/h6,10,14,16-17,19H,2-5,7-9,11-13,15H2,1H3,(H2,21,22,23);1H |
| InChIKey | JLRRRORKUGEMMP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|