C20H30IN3O2S2 — CID 110057075
1-(3-ethylsulfinylcyclohexyl)-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110057075) has the molecular formula C20H30IN3O2S2 and a molecular weight of 535.52 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110057075 |
| Molecular Formula | C20H30IN3O2S2 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/Cc2cccs2)NCCc2ccco2)C1.I |
| InChI | InChI=1S/C20H29N3O2S2.HI/c1-2-27(24)19-9-3-6-16(14-19)23-20(22-15-18-8-5-13-26-18)21-11-10-17-7-4-12-25-17;/h4-5,7-8,12-13,16,19H,2-3,6,9-11,14-15H2,1H3,(H2,21,22,23);1H |
| InChIKey | WSXFPXAEZCAVNE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|