C24H36N4OS — CID 110060808
1-[2-(furan-2-yl)ethyl]-3-[4-(4-methylpiperidin-1-yl)cyclohexyl]-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 110060808) has the molecular formula C24H36N4OS and a molecular weight of 428.65 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-[4-(4-methylpiperidin-1-yl)cyclohexyl]-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-[4-(4-methylpiperidin-1-yl)cyclohexyl]-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110060808 |
| Molecular Formula | C24H36N4OS |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-[4-(4-methylpiperidin-1-yl)cyclohexyl]-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CC1CCN(C2CCC(N/C(=N/Cc3cccs3)NCCc3ccco3)CC2)CC1 |
| InChI | InChI=1S/C24H36N4OS/c1-19-11-14-28(15-12-19)21-8-6-20(7-9-21)27-24(26-18-23-5-3-17-30-23)25-13-10-22-4-2-16-29-22/h2-5,16-17,19-21H,6-15,18H2,1H3,(H2,25,26,27) |
| InChIKey | LTDFMPRLSASAHL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|