C21H25N5OS — CID 110060938
1-[2-(furan-2-yl)ethyl]-3-(1-pyridin-2-ylpyrrolidin-3-yl)-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 110060938) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(1-pyridin-2-ylpyrrolidin-3-yl)-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(1-pyridin-2-ylpyrrolidin-3-yl)-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110060938 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(1-pyridin-2-ylpyrrolidin-3-yl)-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | c1ccc(N2CCC(N/C(=N/Cc3cccs3)NCCc3ccco3)C2)nc1 |
| InChI | InChI=1S/C21H25N5OS/c1-2-10-22-20(7-1)26-12-9-17(16-26)25-21(24-15-19-6-4-14-28-19)23-11-8-18-5-3-13-27-18/h1-7,10,13-14,17H,8-9,11-12,15-16H2,(H2,23,24,25) |
| InChIKey | JCNHPTFSFGAXPK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|