C23H34N4OS — CID 110056472
1-(1-cyclohexylpiperidin-4-yl)-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 110056472) has the molecular formula C23H34N4OS and a molecular weight of 414.62 g/mol. Its IUPAC name is 1-(1-cyclohexylpiperidin-4-yl)-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-(1-cyclohexylpiperidin-4-yl)-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110056472 |
| Molecular Formula | C23H34N4OS |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 1-(1-cyclohexylpiperidin-4-yl)-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | c1coc(CCN/C(=N\Cc2cccs2)NC2CCN(C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C23H34N4OS/c1-2-6-20(7-3-1)27-14-11-19(12-15-27)26-23(25-18-22-9-5-17-29-22)24-13-10-21-8-4-16-28-21/h4-5,8-9,16-17,19-20H,1-3,6-7,10-15,18H2,(H2,24,25,26) |
| InChIKey | LWRGXENYZIYCJT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|