C17H23N3OS2 — CID 110058906
1-[2-(furan-2-yl)ethyl]-3-(thiolan-2-ylmethyl)-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 110058906) has the molecular formula C17H23N3OS2 and a molecular weight of 349.53 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(thiolan-2-ylmethyl)-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(thiolan-2-ylmethyl)-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110058906 |
| Molecular Formula | C17H23N3OS2 |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(thiolan-2-ylmethyl)-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | c1coc(CCN/C(=N\Cc2cccs2)NCC2CCCS2)c1 |
| InChI | InChI=1S/C17H23N3OS2/c1-4-14(21-9-1)7-8-18-17(19-12-15-5-2-10-22-15)20-13-16-6-3-11-23-16/h1-2,4-5,9-10,16H,3,6-8,11-13H2,(H2,18,19,20) |
| InChIKey | BLVQOUOZYDDAOH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|