C19H24IN3O3S — CID 111516762
1-[2-(furan-2-yl)ethyl]-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111516762) has the molecular formula C19H24IN3O3S and a molecular weight of 501.39 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111516762 |
| Molecular Formula | C19H24IN3O3S |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CC(O)(CN/C(=N/Cc1cccs1)NCCc1ccco1)c1ccco1.I |
| InChI | InChI=1S/C19H23N3O3S.HI/c1-19(23,17-7-3-11-25-17)14-22-18(21-13-16-6-4-12-26-16)20-9-8-15-5-2-10-24-15;/h2-7,10-12,23H,8-9,13-14H2,1H3,(H2,20,21,22);1H |
| InChIKey | KLRGHKGZRNMYFA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|