C21H29IN4O2S — CID 110058473
2-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 110058473) has the molecular formula C21H29IN4O2S and a molecular weight of 528.46 g/mol. Its IUPAC name is 2-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110058473 |
| Molecular Formula | C21H29IN4O2S |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 2-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCc1noc(CC)c1C/N=C(\NCCc1ccco1)NCCc1cccs1.I |
| InChI | InChI=1S/C21H28N4O2S.HI/c1-3-19-18(20(4-2)27-25-19)15-24-21(22-11-9-16-7-5-13-26-16)23-12-10-17-8-6-14-28-17;/h5-8,13-14H,3-4,9-12,15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | PEXHOUGMQWEBEB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|