C17H17F3N4OS2 — CID 111615547
1-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111615547) has the molecular formula C17H17F3N4OS2 and a molecular weight of 414.48 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111615547 |
| Molecular Formula | C17H17F3N4OS2 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | FC(F)(F)c1csc(CN/C(=N/Cc2cccs2)NCCc2ccco2)n1 |
| InChI | InChI=1S/C17H17F3N4OS2/c18-17(19,20)14-11-27-15(24-14)10-23-16(22-9-13-4-2-8-26-13)21-6-5-12-3-1-7-25-12/h1-4,7-8,11H,5-6,9-10H2,(H2,21,22,23) |
| InChIKey | PZYCFJHOGOFMEN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|