C20H27IN4OS2 — CID 110060083
2-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-1-[2-(furan-2-yl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 110060083) has the molecular formula C20H27IN4OS2 and a molecular weight of 530.50 g/mol. Its IUPAC name is 2-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-1-[2-(furan-2-yl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-1-[2-(furan-2-yl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110060083 |
| Molecular Formula | C20H27IN4OS2 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | 2-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-1-[2-(furan-2-yl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | Cc1nc(CC/N=C(\NCCc2ccco2)NCCc2cccs2)sc1C.I |
| InChI | InChI=1S/C20H26N4OS2.HI/c1-15-16(2)27-19(24-15)9-12-23-20(21-10-7-17-5-3-13-25-17)22-11-8-18-6-4-14-26-18;/h3-6,13-14H,7-12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | DYUCRASAIAJFAG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|