C19H25IN4OS2 — CID 110056961
3-[2-(furan-2-yl)ethyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 110056961) has the molecular formula C19H25IN4OS2 and a molecular weight of 516.47 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)ethyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 3-[2-(furan-2-yl)ethyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110056961 |
| Molecular Formula | C19H25IN4OS2 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | 3-[2-(furan-2-yl)ethyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | Cc1nc(CN(C)/C(=N/CCc2cccs2)NCCc2ccco2)cs1.I |
| InChI | InChI=1S/C19H24N4OS2.HI/c1-15-22-16(14-26-15)13-23(2)19(20-9-7-17-5-3-11-24-17)21-10-8-18-6-4-12-25-18;/h3-6,11-12,14H,7-10,13H2,1-2H3,(H,20,21);1H |
| InChIKey | CTEKWORWEWXKEU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|