C20H32IN5OS — CID 109423755
3-ethyl-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109423755) has the molecular formula C20H32IN5OS and a molecular weight of 517.48 g/mol. Its IUPAC name is 3-ethyl-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109423755 |
| Molecular Formula | C20H32IN5OS |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 3-ethyl-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccco1)N1CCCCC1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C20H31N5OS.HI/c1-4-21-20(24(3)14-17-15-27-16(2)23-17)22-13-18(19-9-8-12-26-19)25-10-6-5-7-11-25;/h8-9,12,15,18H,4-7,10-11,13-14H2,1-3H3,(H,21,22);1H |
| InChIKey | HQJPGDDFZGGERG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|