C20H26ClIN6S — CID 109423011
2-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109423011) has the molecular formula C20H26ClIN6S and a molecular weight of 544.89 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109423011 |
| Molecular Formula | C20H26ClIN6S |
| Molecular Weight | 544.89 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(Cl)cc1)n1cccn1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C20H25ClN6S.HI/c1-4-22-20(26(3)13-18-14-28-15(2)25-18)23-12-19(27-11-5-10-24-27)16-6-8-17(21)9-7-16;/h5-11,14,19H,4,12-13H2,1-3H3,(H,22,23);1H |
| InChIKey | UNAKYBDWDVNMMR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.89 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|