C21H30ClN5OS — CID 109423164
2-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109423164) has the molecular formula C21H30ClN5OS and a molecular weight of 436.03 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 2-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109423164 |
| Molecular Formula | C21H30ClN5OS |
| Molecular Weight | 436.03 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(c1cccc(Cl)c1)N1CCOCC1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C21H30ClN5OS/c1-4-23-21(26(3)14-19-15-29-16(2)25-19)24-13-20(27-8-10-28-11-9-27)17-6-5-7-18(22)12-17/h5-7,12,15,20H,4,8-11,13-14H2,1-3H3,(H,23,24) |
| InChIKey | JVYOTODPBVIASV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.03 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|