C18H21ClN6OS — CID 109421770
2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109421770) has the molecular formula C18H21ClN6OS and a molecular weight of 404.93 g/mol. Its IUPAC name is 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109421770 |
| Molecular Formula | C18H21ClN6OS |
| Molecular Weight | 404.93 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(-c2cccc(Cl)c2)no1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C18H21ClN6OS/c1-4-20-18(25(3)10-15-11-27-12(2)22-15)21-9-16-23-17(24-26-16)13-6-5-7-14(19)8-13/h5-8,11H,4,9-10H2,1-3H3,(H,20,21) |
| InChIKey | NHFDUGJUFHEQJH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.93 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|