C19H24IN5S — CID 109421235
3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(quinolin-8-ylmethyl)guanidine;hydroiodide (PubChem CID 109421235) has the molecular formula C19H24IN5S and a molecular weight of 481.41 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(quinolin-8-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(quinolin-8-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109421235 |
| Molecular Formula | C19H24IN5S |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(quinolin-8-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc2cccnc12)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C19H23N5S.HI/c1-4-20-19(24(3)12-17-13-25-14(2)23-17)22-11-16-8-5-7-15-9-6-10-21-18(15)16;/h5-10,13H,4,11-12H2,1-3H3,(H,20,22);1H |
| InChIKey | BXAHNAMZZDCNIO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|