C22H28IN5OS — CID 109421379
3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 109421379) has the molecular formula C22H28IN5OS and a molecular weight of 537.47 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109421379 |
| Molecular Formula | C22H28IN5OS |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1OCc1ccccc1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C22H27N5OS.HI/c1-4-23-22(27(3)14-20-16-29-17(2)26-20)25-13-19-11-8-12-24-21(19)28-15-18-9-6-5-7-10-18;/h5-12,16H,4,13-15H2,1-3H3,(H,23,25);1H |
| InChIKey | RWXXDLCSLKUUQV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|