C23H34IN5O2 — CID 111009230
N,N-diethyl-2-[[N-ethyl-N'-[(2-phenylmethoxy-3-pyridinyl)methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide (PubChem CID 111009230) has the molecular formula C23H34IN5O2 and a molecular weight of 539.46 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-[(2-phenylmethoxy-3-pyridinyl)methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-[(2-phenylmethoxy-3-pyridinyl)methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111009230 |
| Molecular Formula | C23H34IN5O2 |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-[(2-phenylmethoxy-3-pyridinyl)methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1OCc1ccccc1)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C23H33N5O2.HI/c1-5-24-23(27(4)17-21(29)28(6-2)7-3)26-16-20-14-11-15-25-22(20)30-18-19-12-9-8-10-13-19;/h8-15H,5-7,16-18H2,1-4H3,(H,24,26);1H |
| InChIKey | FMDZQAFXSCLBDG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|