C15H27IN4OS — CID 111009698
N,N-diethyl-2-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]-methylamino]acetamide;hydroiodide (PubChem CID 111009698) has the molecular formula C15H27IN4OS and a molecular weight of 438.38 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]-methylamino]acetamide;hydroiodide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]-methylamino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111009698 |
| Molecular Formula | C15H27IN4OS |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]-methylamino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccs1)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C15H26N4OS.HI/c1-5-16-15(17-11-13-9-8-10-21-13)18(4)12-14(20)19(6-2)7-3;/h8-10H,5-7,11-12H2,1-4H3,(H,16,17);1H |
| InChIKey | JKHUCLHGJPHJGK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|