C19H34IN5O — CID 111010494
2-[[N'-[[3-(dimethylamino)phenyl]methyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide (PubChem CID 111010494) has the molecular formula C19H34IN5O and a molecular weight of 475.42 g/mol. Its IUPAC name is 2-[[N'-[[3-(dimethylamino)phenyl]methyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[[3-(dimethylamino)phenyl]methyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111010494 |
| Molecular Formula | C19H34IN5O |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-[[N'-[[3-(dimethylamino)phenyl]methyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(N(C)C)c1)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C19H33N5O.HI/c1-7-20-19(23(6)15-18(25)24(8-2)9-3)21-14-16-11-10-12-17(13-16)22(4)5;/h10-13H,7-9,14-15H2,1-6H3,(H,20,21);1H |
| InChIKey | XPZRNYBOMSISQI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|