C22H38N6O2 — CID 111009579
3-[[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 111009579) has the molecular formula C22H38N6O2 and a molecular weight of 418.59 g/mol. Its IUPAC name is 3-[[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 111009579 |
| Molecular Formula | C22H38N6O2 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | 3-[[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NCCN(C)C)c1)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C22H38N6O2/c1-7-23-22(27(6)17-20(29)28(8-2)9-3)25-16-18-11-10-12-19(15-18)21(30)24-13-14-26(4)5/h10-12,15H,7-9,13-14,16-17H2,1-6H3,(H,23,25)(H,24,30) |
| InChIKey | KNRYYWIFQYNGLM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|