C18H28F3IN4O — CID 111010000
N,N-diethyl-2-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide (PubChem CID 111010000) has the molecular formula C18H28F3IN4O and a molecular weight of 500.35 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111010000 |
| Molecular Formula | C18H28F3IN4O |
| Molecular Weight | 500.35 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C18H27F3N4O.HI/c1-5-22-17(24(4)13-16(26)25(6-2)7-3)23-12-14-9-8-10-15(11-14)18(19,20)21;/h8-11H,5-7,12-13H2,1-4H3,(H,22,23);1H |
| InChIKey | PYURTXKUAUCJOL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|