C18H29F3IN5O2 — CID 111009222
N,N-diethyl-2-[[N-ethyl-N'-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide (PubChem CID 111009222) has the molecular formula C18H29F3IN5O2 and a molecular weight of 531.36 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111009222 |
| Molecular Formula | C18H29F3IN5O2 |
| Molecular Weight | 531.36 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]carbamimidoyl]-methylamino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(OCC(F)(F)F)c1)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C18H28F3N5O2.HI/c1-5-22-17(25(4)12-16(27)26(6-2)7-3)24-11-14-8-9-23-15(10-14)28-13-18(19,20)21;/h8-10H,5-7,11-13H2,1-4H3,(H,22,24);1H |
| InChIKey | IMILWBPZXOEJBL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|