C20H32F2N4O3 — CID 111009309
2-[[N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide (PubChem CID 111009309) has the molecular formula C20H32F2N4O3 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-[[N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[[N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 111009309 |
| Molecular Formula | C20H32F2N4O3 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 2-[[N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide |
| SMILES | CCN/C(=N\Cc1ccc(OC(F)F)c(OCC)c1)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C20H32F2N4O3/c1-6-23-20(25(5)14-18(27)26(7-2)8-3)24-13-15-10-11-16(29-19(21)22)17(12-15)28-9-4/h10-12,19H,6-9,13-14H2,1-5H3,(H,23,24) |
| InChIKey | BEOMDMPRNJLFEB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|