C17H27FN4O — CID 111010475
N,N-diethyl-2-[[N-ethyl-N'-[(3-fluorophenyl)methyl]carbamimidoyl]-methylamino]acetamide (PubChem CID 111010475) has the molecular formula C17H27FN4O and a molecular weight of 322.43 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-[(3-fluorophenyl)methyl]carbamimidoyl]-methylamino]acetamide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-[(3-fluorophenyl)methyl]carbamimidoyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 111010475 |
| Molecular Formula | C17H27FN4O |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-[(3-fluorophenyl)methyl]carbamimidoyl]-methylamino]acetamide |
| SMILES | CCN/C(=N\Cc1cccc(F)c1)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C17H27FN4O/c1-5-19-17(20-12-14-9-8-10-15(18)11-14)21(4)13-16(23)22(6-2)7-3/h8-11H,5-7,12-13H2,1-4H3,(H,19,20) |
| InChIKey | ZRZAFXVEIARMIH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|