C21H36IN5O2 — CID 111009368
N-benzyl-2-[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]-N-ethylacetamide;hydroiodide (PubChem CID 111009368) has the molecular formula C21H36IN5O2 and a molecular weight of 517.46 g/mol. Its IUPAC name is N-benzyl-2-[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]-N-ethylacetamide;hydroiodide.
| Compound Name | N-benzyl-2-[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]-N-ethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111009368 |
| Molecular Formula | C21H36IN5O2 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | N-benzyl-2-[[[[2-(diethylamino)-2-oxoethyl]-methylamino]-(ethylamino)methylidene]amino]-N-ethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(CC)Cc1ccccc1)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C21H35N5O2.HI/c1-6-22-21(24(5)17-20(28)25(7-2)8-3)23-15-19(27)26(9-4)16-18-13-11-10-12-14-18;/h10-14H,6-9,15-17H2,1-5H3,(H,22,23);1H |
| InChIKey | VPVNDVHGRGVIOW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|