C21H37IN4O2 — CID 111009366
N,N-diethyl-2-[[N-ethyl-N'-(2-methyl-3-phenylmethoxypropyl)carbamimidoyl]-methylamino]acetamide;hydroiodide (PubChem CID 111009366) has the molecular formula C21H37IN4O2 and a molecular weight of 504.46 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-(2-methyl-3-phenylmethoxypropyl)carbamimidoyl]-methylamino]acetamide;hydroiodide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-(2-methyl-3-phenylmethoxypropyl)carbamimidoyl]-methylamino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111009366 |
| Molecular Formula | C21H37IN4O2 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-(2-methyl-3-phenylmethoxypropyl)carbamimidoyl]-methylamino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)COCc1ccccc1)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C21H36N4O2.HI/c1-6-22-21(24(5)15-20(26)25(7-2)8-3)23-14-18(4)16-27-17-19-12-10-9-11-13-19;/h9-13,18H,6-8,14-17H2,1-5H3,(H,22,23);1H |
| InChIKey | NSCHPWGPHYZDPS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|